BIOPEP-UWM: Report
| ID | 10376 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 3 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 355.4129 | Monoisotopic mass | 355.1310 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Du Z., Wang D., Li Y. | |
| Title | |
| Comprehensive Evaluation and Comparison of Machine Learning Methods in QSAR Modeling of Antioxidant Tripeptides. ACS omega, 7(29), 25760-25771, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@]([H])(CS)C(=O)O InChI=1S/C14H21N5O4S/c20-12(9-2-1-3-16-9)18-10(4-8-5-15-7-17-8)13(21)19-11(6-24)14(22)23/h5,7,9-11,16,24H,1-4,6H2,(H,15,17)(H,18,20)(H,19,21)(H,22,23)/t9-,10-,11-/m0/s1 InChIKey= DTQIXTOJHKVEOH-DCAQKATOSA-N |
| Database reference: |