BIOPEP-UWM: Report
| ID | 10380 |
| Name | Dipeptidyl peptidase IV inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 5 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 473.5209 | Monoisotopic mass | 473.2267 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| He L., Wang X., Wang Y., Luo J., Zhao Y., Han G., Han L., Yu Q. | |
| Title | |
| Production and identification of dipeptidyl peptidase IV (DPP-IV) inhibitory peptides from discarded cowhide collagen. Food Chemistry, 405, 134793, 2023 | |
| Year | Source |
| 2023 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1))C(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C23H31N5O6/c24-16(12-15-6-2-1-3-7-15)21(31)25-13-19(29)27-10-4-8-17(27)22(32)26-14-20(30)28-11-5-9-18(28)23(33)34/h1-3,6-7,16-18H,4-5,8-14,24H2,(H,25,31)(H,26,32)(H,33,34)/t16-,17-,18-/m0/s1 InChIKey= JZIASZGKIKKSJS-BZSNNMDCSA-N |
| Database reference: |