BIOPEP-UWM: Report
| ID | 10383 |
| Name | Dipeptidyl peptidase IV inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 7 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 579.6442 | Monoisotopic mass | 579.3007 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| He L., Wang X., Wang Y., Luo J., Zhao Y., Han G., Han L., Yu Q. | |
| Title | |
| Production and identification of dipeptidyl peptidase IV (DPP-IV) inhibitory peptides from discarded cowhide collagen. Food Chemistry, 405, 134793, 2023 | |
| Year | Source |
| 2023 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C(C)C)C(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)O InChI=1S/C26H41N7O8/c1-15(2)22(30-24(39)17-7-3-9-31(17)19(34)12-27)25(40)28-13-20(35)32-10-5-8-18(32)26(41)33-11-4-6-16(33)23(38)29-14-21(36)37/h15-18,22H,3-14,27H2,1-2H3,(H,28,40)(H,29,38)(H,30,39)(H,36,37)/t16-,17-,18-,22-/m0/s1 InChIKey= BXDJCQURUMWFJP-ORGXJRBJSA-N |
| Database reference: |