BIOPEP-UWM: Report
| ID | 10386 |
| Name | Dipeptidyl peptidase IV inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 4 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 408.5377 | Monoisotopic mass | 408.1495 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ding L., Ma R., You H., Li J., Ge Q., Yu Z., Wang L. | |
| Title | |
| Identification and characterization of dipeptidyl peptidase IV inhibitory peptides from wheat gluten proteins. Journal of Cereal Science, 103, 103396, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCSC)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CCSC)C(=O)NCC(=O)O InChI=1S/C15H28N4O5S2/c1-9(18-14(23)10(16)4-6-25-2)13(22)19-11(5-7-26-3)15(24)17-8-12(20)21/h9-11H,4-8,16H2,1-3H3,(H,17,24)(H,18,23)(H,19,22)(H,20,21)/t9-,10-,11-/m0/s1 InChIKey= LOVIARBNWGPWHY-DCAQKATOSA-N |
| Database reference: |