BIOPEP-UWM: Report
| ID | 10387 |
| Name | Dipeptidyl peptidase IV inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 5 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 483.5999 | Monoisotopic mass | 483.3047 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ding L., Ma R., You H., Li J., Ge Q., Yu Z., Wang L. | |
| Title | |
| Identification and characterization of dipeptidyl peptidase IV inhibitory peptides from wheat gluten proteins. Journal of Cereal Science, 103, 103396, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(C(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C(C)C)C(=O)O InChI=1S/C23H41N5O6/c1-11(2)16(24)21(31)25-14(7)19(29)26-17(12(3)4)22(32)28-10-8-9-15(28)20(30)27-18(13(5)6)23(33)34/h11-18H,8-10,24H2,1-7H3,(H,25,31)(H,26,29)(H,27,30)(H,33,34)/t14-,15-,16-,17-,18-/m0/s1 InChIKey= BSBPJMRZELRKON-ATIWLJMLSA-N |
| Database reference: |