BIOPEP-UWM: Report
| ID | 10391 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 3 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 387.3890 | Monoisotopic mass | 387.1538 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Seo H.-S., Kwak S.-Y., Lee Y.-S. | |
| Title | |
| Antioxidative activities of histidine containing caffeic acid-dipeptides. Bioorg. Med. Chem. Lett., 20, 4266–4272, 2010 | |
| Year | Source |
| 2010 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: OC1=C(O)C=C(C=C1)/C=C/C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@]([H])(C)C(=O)N InChI=1S/C18H21N5O5/c1-10(17(19)27)22-18(28)13(7-12-8-20-9-21-12)23-16(26)5-3-11-2-4-14(24)15(25)6-11/h2-6,8-10,13,24-25H,7H2,1H3,(H2,19,27)(H,20,21)(H,22,28)(H,23,26)/b5-3+/t10-,13-/m0/s1 InChIKey=YBZONJKWGGHAQH-KHDIDITISA-N <C3:1(2E)[3ph;6OH;7OH]> - caffeic acid; BIOPEP-UWM repository of amino acids and modifications ID 107 ~ - C-terminal amide group (BIOPEP-UWM repository amino of acids and modifications: ID 75) |
| Database reference: |
| ChEMBL: ID CHEMBL1171032 ChemSpider: ID 25034975 PubChem: CID 49798486 |