BIOPEP-UWM: Report
| ID | 10402 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 3 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 444.4831 | Monoisotopic mass | 444.2115 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Seo H.-S., Kwak S.-Y., Lee Y.-S. | |
| Title | |
| Antioxidative activities of histidine containing caffeic acid-dipeptides. Bioorg. Med. Chem. Lett., 20, 4266–4272, 2010 | |
| Year | Source |
| 2010 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: OC1=C(O)C=C(C=C1)/C=C/C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@]([H])(CCCCN)C(=O)N InChI=1S/C21H28N6O5/c22-8-2-1-3-15(20(23)31)27-21(32)16(10-14-11-24-12-25-14)26-19(30)7-5-13-4-6-17(28)18(29)9-13/h4-7,9,11-12,15-16,28-29H,1-3,8,10,22H2,(H2,23,31)(H,24,25)(H,26,30)(H,27,32)/b7-5+/t15-,16-/m0/s1 InChIKey=UXPNZJWOMMVNJB-MCXNIAKKSA-N {C3:1(2E)[3ph;6OH;7OH]} - caffeic acid; BIOPEP-UWM repository of amino acids and modifications ID 107 ~ - C-terminal amide group (BIOPEP-UWM repository amino of acids and modifications: ID 75) |
| Database reference: |
| ChEMBL: ID CHEMBL1171587 ChemSpider: ID 25061014 PubChem: CID 49798458 |