BIOPEP-UWM: Report
| ID | 10411 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 9 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 965.1655 | Monoisotopic mass | 964.5035 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Fan X., Han Y., Sun Y., Zhang T., Tu M., Du L., Pan D. | |
| Title | |
| Preparation and characterization of duck liver-derived antioxidant peptides based on LC-MS/MS, molecular docking, and machine learning. LWT, 175, 114479, 2023 | |
| Year | Source |
| 2023 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCSC)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)NCC(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCCCN)C(=O)O InChI=1S/C44H72N10O12S/c1-23(2)34(41(62)49-30(44(65)66)11-8-9-18-45)52-40(61)32-12-10-19-54(32)43(64)36(26(6)55)53-42(63)35(24(3)4)51-37(58)25(5)48-33(57)22-47-39(60)31(21-27-13-15-28(56)16-14-27)50-38(59)29(46)17-20-67-7/h13-16,23-26,29-32,34-36,55-56H,8-12,17-22,45-46H2,1-7H3,(H,47,60)(H,48,57)(H,49,62)(H,50,59)(H,51,58)(H,52,61)(H,53,63)(H,65,66)/t25-,26+,29-,30-,31-,32-,34-,35-,36-/m0/s1 InChIKey=FGYUNSKUTJKPST-PHBDXZLPSA-N |
| Database reference: |