BIOPEP-UWM: Report
| ID | 10412 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 6 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 844.9550 | Monoisotopic mass | 844.4542 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Fan X., Han Y., Sun Y., Zhang T., Tu M., Du L., Pan D. | |
| Title | |
| Preparation and characterization of duck liver-derived antioxidant peptides based on LC-MS/MS, molecular docking, and machine learning. LWT, 175, 114479, 2023 | |
| Year | Source |
| 2023 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(=O)N)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C38H60N12O10/c1-3-20(2)31(36(58)48-27(37(59)60)12-8-16-44-38(42)43)50-34(56)25(11-6-7-15-39)46-33(55)26(13-14-30(52)53)47-35(57)28(49-32(54)23(40)18-29(41)51)17-21-19-45-24-10-5-4-9-22(21)24/h4-5,9-10,19-20,23,25-28,31,45H,3,6-8,11-18,39-40H2,1-2H3,(H2,41,51)(H,46,55)(H,47,57)(H,48,58)(H,49,54)(H,50,56)(H,52,53)(H,59,60)(H4,42,43,44)/t20-,23-,25-,26-,27-,28-,31-/m0/s1 InChIKey=RZRYIFJBBWWQKQ-FPXPZXHUSA-N |
| Database reference: |