BIOPEP-UWM: Report
| ID | 10413 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 7 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 722.8735 | Monoisotopic mass | 722.4426 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Fan X., Han Y., Sun Y., Zhang T., Tu M., Du L., Pan D. | |
| Title | |
| Preparation and characterization of duck liver-derived antioxidant peptides based on LC-MS/MS, molecular docking, and machine learning. LWT, 175, 114479, 2023 | |
| Year | Source |
| 2023 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C)C(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C33H58N10O8/c1-6-18(3)25(40-24(44)17-38-27(45)22-12-9-15-42(22)30(48)20(5)34)29(47)41-26(19(4)7-2)31(49)43-16-10-13-23(43)28(46)39-21(32(50)51)11-8-14-37-33(35)36/h18-23,25-26H,6-17,34H2,1-5H3,(H,38,45)(H,39,46)(H,40,44)(H,41,47)(H,50,51)(H4,35,36,37)/t18-,19-,20-,21-,22-,23-,25-,26-/m0/s1 InChIKey=SMJLSSBFDJSDSW-SSHVMUOYSA-N |
| Database reference: |