BIOPEP-UWM: Report
| ID | 10414 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 6 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 944.0907 | Monoisotopic mass | 943.5127 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Fan X., Han Y., Sun Y., Zhang T., Tu M., Du L., Pan D. | |
| Title | |
| Preparation and characterization of duck liver-derived antioxidant peptides based on LC-MS/MS, molecular docking, and machine learning. LWT, 175, 114479, 2023 | |
| Year | Source |
| 2023 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C45H65N15O8/c1-24(2)19-34(40(64)57-33(43(67)68)14-8-18-53-45(50)51)59-39(63)32(15-16-37(47)61)56-41(65)36(21-26-23-55-31-13-6-4-10-28(26)31)60-42(66)35(20-25-22-54-30-12-5-3-9-27(25)30)58-38(62)29(46)11-7-17-52-44(48)49/h3-6,9-10,12-13,22-24,29,32-36,54-55H,7-8,11,14-21,46H2,1-2H3,(H2,47,61)(H,56,65)(H,57,64)(H,58,62)(H,59,63)(H,60,66)(H,67,68)(H4,48,49,52)(H4,50,51,53)/t29-,32-,33-,34-,35-,36-/m0/s1 InChIKey=AQAIHXZJYOIEHX-UJARKJSPSA-N |
| Database reference: |