BIOPEP-UWM: Report
| ID | 10415 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 12 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 1411.5575 | Monoisotopic mass | 1410.7233 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ren L., Fan J., Yang Y., Liu X., Wang B., Bian X., Wang D., Xu Y., Liu B., Zhu P., Zhang N. | |
| Title | |
| Identification, in silico selection, and mechanism study of novel antioxidant peptides derived from the rice bran protein hydrolysates. Food Chem., 408, 135230, 2023 | |
| Year | Source |
| 2023 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)NCC(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C63H98N18O19/c1-7-34(6)51(60(97)79-44(24-33(4)5)61(98)81-22-12-16-46(81)59(96)75-40(62(99)100)15-11-21-69-63(66)67)80-55(92)39(18-20-49(85)86)74-58(95)45(30-82)72-48(84)29-70-53(90)42(25-35-13-9-8-10-14-35)77-57(94)43(27-50(87)88)78-54(91)38(17-19-47(65)83)73-56(93)41(23-32(2)3)76-52(89)37(64)26-36-28-68-31-71-36/h8-10,13-14,28,31-34,37-46,51,82H,7,11-12,15-27,29-30,64H2,1-6H3,(H2,65,83)(H,68,71)(H,70,90)(H,72,84)(H,73,93)(H,74,95)(H,75,96)(H,76,89)(H,77,94)(H,78,91)(H,79,97)(H,80,92)(H,85,86)(H,87,88)(H,99,100)(H4,66,67,69)/t34-,37-,38-,39-,40-,41-,42-,43-,44-,45-,46-,51-/m0/s1 InChIKey=KKJNVPMVHILEBN-FINGCZPVSA-N |
| Database reference: |