BIOPEP-UWM: Report
| ID | 10420 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 5 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 533.6156 | Monoisotopic mass | 533.2840 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Vitale G. A., Scarpato S., Mangoni A., D’Auria M. V., Della Sala G., de Pascale D. | |
| Title | |
| Enhanced molecular networking shows Microbacterium sp. V1 as a factory of antioxidant proline-rich peptides. Mar. Drugs, 21, 256, 2023 | |
| Year | Source |
| 2023 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N1[C@@]([H])(CCC1(=O))C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C26H39N5O7/c1-15(2)14-17(28-22(33)18-6-3-11-29(18)23(34)16-9-10-21(32)27-16)24(35)30-12-4-7-19(30)25(36)31-13-5-8-20(31)26(37)38/h15-20H,3-14H2,1-2H3,(H,27,32)(H,28,33)(H,37,38)/t16-,17-,18-,19-,20-/m0/s1 InChIKey=FYTXTJDGWWNMDT-HVTWWXFQSA-N {P[4O]} - L-pyroglutamic acid (BIOPEP-UWM repository of amino acids and modifications: ID 110) |
| Database reference: |