BIOPEP-UWM: Report
| ID | 10421 |
| Name | Dipeptidyl peptidase IV inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 10 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 1126.3428 | Monoisotopic mass | 1125.6203 | |
| IC50 : | 12.43 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zan R., Wu Q., Chen Y., Wu G., Zhang H., Zhu L. | |
| Title | |
| Identification of novel dipeptidyl peptidase-IV inhibitory peptides in chickpea protein hydrolysates. J. Agric. Food Chem., 71, 8211–8219, 2023 | |
| Year | Source |
| 2023 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)O InChI=1S/C58H83N11O12/c1-8-32(4)47(59)54(76)62-35(7)50(72)66-49(34(6)10-3)57(79)69-27-15-20-45(69)55(77)67-25-13-18-43(67)52(74)61-31-46(71)65-48(33(5)9-2)56(78)68-26-14-19-44(68)53(75)63-41(28-36-21-23-38(70)24-22-36)51(73)64-42(58(80)81)29-37-30-60-40-17-12-11-16-39(37)40/h11-12,16-17,21-24,30,32-35,41-45,47-49,60,70H,8-10,13-15,18-20,25-29,31,59H2,1-7H3,(H,61,74)(H,62,76)(H,63,75)(H,64,73)(H,65,71)(H,66,72)(H,80,81)/t32-,33-,34-,35-,41-,42-,43-,44-,45-,47-,48-,49-/m0/s1 InChIKey=CCGCJTVFWISYNO-DTBLYLSPSA-N |
| Database reference: |