BIOPEP-UWM: Report
| ID | 10422 |
| Name | Dipeptidyl peptidase IV inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 7 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 828.9507 | Monoisotopic mass | 828.4157 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zan R., Wu Q., Chen Y., Wu G., Zhang H., Zhu L. | |
| Title | |
| Identification of novel dipeptidyl peptidase-IV inhibitory peptides in chickpea protein hydrolysates. J. Agric. Food Chem., 71, 8211–8219, 2023 | |
| Year | Source |
| 2023 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)O InChI=1S/C43H56N8O9/c1-3-25(2)37(49-36(53)24-46-39(55)34-12-7-19-50(34)41(57)31-11-6-18-44-31)42(58)51-20-8-13-35(51)40(56)47-32(21-26-14-16-28(52)17-15-26)38(54)48-33(43(59)60)22-27-23-45-30-10-5-4-9-29(27)30/h4-5,9-10,14-17,23,25,31-35,37,44-45,52H,3,6-8,11-13,18-22,24H2,1-2H3,(H,46,55)(H,47,56)(H,48,54)(H,49,53)(H,59,60)/t25-,31-,32-,33-,34-,35-,37-/m0/s1 InChIKey=JGNBPXNNKMJWQP-SBRODVMZSA-N |
| Database reference: |