BIOPEP-UWM: Report
| ID | 10425 |
| Name | Dipeptidyl peptidase IV inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 8 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 934.0050 | Monoisotopic mass | 933.4654 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhang M., Zhu L., Wu G., Liu T., Qi X., Zhang H. | |
| Title | |
| Rapid screening of novel dipeptidyl peptidase‑4 inhibitory peptides from pea (Pisum sativum L.) protein using peptidomics and molecular docking. J. Agric. Food Chem., 70, 10221−10228, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(C)C(=O)O InChI=1S/C40H63N13O13/c1-19(2)14-23(41)38(64)53-13-5-7-29(53)37(63)51-27(17-31(43)57)34(60)49-25(15-21-8-10-22(55)11-9-21)33(59)50-26(16-30(42)56)35(61)52-28(18-54)36(62)48-24(6-4-12-46-40(44)45)32(58)47-20(3)39(65)66/h8-11,19-20,23-29,54-55H,4-7,12-18,41H2,1-3H3,(H2,42,56)(H2,43,57)(H,47,58)(H,48,62)(H,49,60)(H,50,59)(H,51,63)(H,52,61)(H,65,66)(H4,44,45,46)/t20-,23-,24-,25-,26-,27-,28-,29-/m0/s1 InChIKey=RVLJKWBQCLENMO-WVQSQKPFSA-N |
| Database reference: |