BIOPEP-UWM: Report
| ID | 10426 |
| Name | Dipeptidyl peptidase IV inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 6 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 841.9462 | Monoisotopic mass | 841.3997 | |
| IC50 : | 11.04 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhang M., Zhu L., Wu G., Liu T., Qi X., Zhang H. | |
| Title | |
| Rapid screening of novel dipeptidyl peptidase‑4 inhibitory peptides from pea (Pisum sativum L.) protein using peptidomics and molecular docking. J. Agric. Food Chem., 70, 10221−10228, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])([C@]([H])(CC)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)O InChI=1S/C44H55N7O10/c1-4-24(2)37(45)43(59)51-19-7-10-36(51)41(57)48-33(20-26-11-15-29(53)16-12-26)39(55)47-34(22-28-23-46-32-9-6-5-8-31(28)32)40(56)50-38(25(3)52)42(58)49-35(44(60)61)21-27-13-17-30(54)18-14-27/h5-6,8-9,11-18,23-25,33-38,46,52-54H,4,7,10,19-22,45H2,1-3H3,(H,47,55)(H,48,57)(H,49,58)(H,50,56)(H,60,61)/t24-,25+,33-,34-,35-,36-,37-,38-/m0/s1 InChIKey=DPXOVRHJOGVFCU-UPYBLCCISA-N |
| Database reference: |