BIOPEP-UWM: Report
| ID | 10427 |
| Name | Dipeptidyl peptidase IV inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 5 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 678.7733 | Monoisotopic mass | 678.3366 | |
| IC50 : | 18.29 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhang M., Zhu L., Wu G., Liu T., Qi X., Zhang H. | |
| Title | |
| Rapid screening of novel dipeptidyl peptidase‑4 inhibitory peptides from pea (Pisum sativum L.) protein using peptidomics and molecular docking. J. Agric. Food Chem., 70, 10221−10228, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])([C@]([H])(CC)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)O InChI=1S/C35H46N6O8/c1-4-19(2)29(36)34(47)41-15-7-10-28(41)33(46)39-26(16-21-11-13-23(43)14-12-21)31(44)38-27(32(45)40-30(20(3)42)35(48)49)17-22-18-37-25-9-6-5-8-24(22)25/h5-6,8-9,11-14,18-20,26-30,37,42-43H,4,7,10,15-17,36H2,1-3H3,(H,38,44)(H,39,46)(H,40,45)(H,48,49)/t19-,20+,26-,27-,28-,29-,30-/m0/s1 InChIKey=GJNWIYFLPQGBKA-IEDKDFNTSA-N |
| Database reference: |