BIOPEP-UWM: Report
| ID | 10429 |
| Name | Dipeptidyl peptidase IV inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 9 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 918.9871 | Monoisotopic mass | 918.4432 | |
| IC50 : | 224.35 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhang M., Zhu L., Wu G., Liu T., Qi X., Zhang H. | |
| Title | |
| Rapid screening of novel dipeptidyl peptidase‑4 inhibitory peptides from pea (Pisum sativum L.) protein using peptidomics and molecular docking. J. Agric. Food Chem., 70, 10221−10228, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(C)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)O InChI=1S/C41H62N10O14/c1-21(2)17-25(42)36(59)45-22(3)35(58)50-28(18-24-9-6-5-7-10-24)40(63)51-16-8-11-30(51)39(62)44-19-32(54)47-29(20-52)38(61)46-23(4)34(57)48-26(12-14-31(43)53)37(60)49-27(41(64)65)13-15-33(55)56/h5-7,9-10,21-23,25-30,52H,8,11-20,42H2,1-4H3,(H2,43,53)(H,44,62)(H,45,59)(H,46,61)(H,47,54)(H,48,57)(H,49,60)(H,50,58)(H,55,56)(H,64,65)/t22-,23-,25-,26-,27-,28-,29-,30-/m0/s1 InChIKey=JTLSMMDHXBGDCH-CJKZIAQFSA-N |
| Database reference: |