BIOPEP-UWM: Report
| ID | 10430 |
| Name | Dipeptidyl peptidase IV inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 7 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 843.9191 | Monoisotopic mass | 843.3790 | |
| IC50 : | 207.82 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhang M., Zhu L., Wu G., Liu T., Qi X., Zhang H. | |
| Title | |
| Rapid screening of novel dipeptidyl peptidase‑4 inhibitory peptides from pea (Pisum sativum L.) protein using peptidomics and molecular docking. J. Agric. Food Chem., 70, 10221−10228, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1))C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(CCC(=O)O)C(=O)NCC(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)O InChI=1S/C43H53N7O11/c1-26(51)37(43(60)61)49-35(52)25-45-38(55)31(19-20-36(53)54)46-39(56)32(23-28-14-7-3-8-15-28)47-40(57)33(24-29-16-9-4-10-17-29)48-41(58)34-18-11-21-50(34)42(59)30(44)22-27-12-5-2-6-13-27/h2-10,12-17,26,30-34,37,51H,11,18-25,44H2,1H3,(H,45,55)(H,46,56)(H,47,57)(H,48,58)(H,49,52)(H,53,54)(H,60,61)/t26-,30+,31+,32+,33+,34+,37+/m1/s1 InChIKey=VMVQUMNJJMUFEU-SZBLEYPGSA-N |
| Database reference: |