BIOPEP-UWM: Report
| ID | 10431 |
| Name | Chemotactic peptide |
| sequence |
| Function: | |||
| Agonist of FPR1 and FPR3 receptors | |||
| Number of residues | 6 |
Activity code | che |
| Activity : | chemotactic |
|||
| Chemical mass | 857.0937 | Monoisotopic mass | 856.3962 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Christophe T., Karlsson A., Dugave C., Rabiet M. J., Boulay F., Dahlgren C. | |
| Title | |
| The synthetic peptide Trp-Lys-Tyr-Met-Val-Met-NH2 specifically activates neutrophils through FPRL1/lipoxin A4 receptors and is an agonist for the orphan monocyte-expressed chemoattractant receptor FPRL2. J. Biol. Chem., 276, 21585-21593, 2001 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@]([H])(CCSC)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@]([H])(CCSC)C(=O)O InChI=1S/C41H60N8O8S2/c1-24(2)35(40(55)47-33(41(56)57)17-20-59-4)49-38(53)32(16-19-58-3)46-39(54)34(21-25-12-14-27(50)15-13-25)48-37(52)31(11-7-8-18-42)45-36(51)29(43)22-26-23-44-30-10-6-5-9-28(26)30/h5-6,9-10,12-15,23-24,29,31-35,44,50H,7-8,11,16-22,42-43H2,1-4H3,(H,45,51)(H,46,54)(H,47,55)(H,48,52)(H,49,53)(H,56,57)/t29-,31-,32-,33+,34-,35-/m0/s1 InChIKey=VQBTUIJFUPRJOH-RSQZODEZSA-N Review: Prevete N., Liotti F., Marone G., Melillo R. M., de Paulis A., 2015, Formyl peptide receptors at the interface of inflammation, angiogenesis and tumor growth. Pharmacol. Res., 102, 184–191 |
| Database reference: |
| CAS: Registry No 211868-45-0 ChEMBL: ID CHEMBL2336645 EPA CompTox: ID DTXSID10332420 IUPHAR/BPS: GtoPdb Ligand ID 1048 J-GLOBAL: ID 200907034796335787 Nikkaji: ID J1.473.123G PubChem: CID 456181 |