BIOPEP-UWM: Report
| ID | 10440 |
| Name | Anti-inflammatory peptide |
| sequence |
| Function: | |||
| Anti-inflammatory | |||
| Number of residues | 8 |
Activity code | ai |
| Activity : | anti inflammatory |
|||
| Chemical mass | 1067.1075 | Monoisotopic mass | 1066.4494 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhao Q., Zheng W., Yuan Z., Wang X., Huang A | |
| Title | |
| Anti-inflammatory effect of two novel peptides derived from Binglangjiang buffalo whey protein in lipopolysaccharide-stimulated RAW264.7 macrophages. Food Chem., 429, 136804, 2023 | |
| Year | Source |
| 2023 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@]([H])(CC(=O)N)C(=O)O InChI=1S/C51H62N12O14/c52-33(24-43(67)68)44(69)57-34(17-18-41(53)65)50(75)63-19-7-12-40(63)49(74)61-37(21-29-10-5-2-6-11-29)46(71)58-35(20-28-8-3-1-4-9-28)45(70)60-38(23-31-26-55-27-56-31)48(73)59-36(22-30-13-15-32(64)16-14-30)47(72)62-39(51(76)77)25-42(54)66/h1-6,8-11,13-16,26-27,33-40,64H,7,12,17-25,52H2,(H2,53,65)(H2,54,66)(H,55,56)(H,57,69)(H,58,71)(H,59,73)(H,60,70)(H,61,74)(H,62,72)(H,67,68)(H,76,77)/t33-,34-,35-,36-,37-,38-,39-,40-/m0/s1 InChIKey=CAUBXGHGTVPWTM-TZPCGENMSA-N |
| Database reference: |