BIOPEP-UWM: Report
| ID | 10441 |
| Name | Anti-inflammatory peptide |
| sequence |
| Function: | |||
| Anti-inflammatory | |||
| Number of residues | 9 |
Activity code | ai |
| Activity : | anti inflammatory |
|||
| Chemical mass | 1087.1814 | Monoisotopic mass | 1086.5118 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhao Q., Zheng W., Yuan Z., Wang X., Huang A | |
| Title | |
| Anti-inflammatory effect of two novel peptides derived from Binglangjiang buffalo whey protein in lipopolysaccharide-stimulated RAW264.7 macrophages. Food Chem., 429, 136804, 2023 | |
| Year | Source |
| 2023 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@]([H])(CO)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CO)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C52H70N12O14/c53-34(24-32-17-19-33(68)20-18-32)43(69)62-40(29-67)50(76)64-23-9-16-42(64)48(74)58-36(25-30-10-3-1-4-11-30)44(70)60-39(28-66)46(72)61-38(27-65)45(71)59-37(26-31-12-5-2-6-13-31)49(75)63-22-8-15-41(63)47(73)57-35(51(77)78)14-7-21-56-52(54)55/h1-6,10-13,17-20,34-42,65-68H,7-9,14-16,21-29,53H2,(H,57,73)(H,58,74)(H,59,71)(H,60,70)(H,61,72)(H,62,69)(H,77,78)(H4,54,55,56)/t34-,35-,36-,37-,38-,39-,40-,41-,42-/m0/s1 InChIKey=COTKQWLFLQSTGD-UTALAWHWSA-N |
| Database reference: |