BIOPEP-UWM: Report
| ID | 10443 |
| Name | Cyclooxygenase-1 inhibitor |
| sequence |
| Function: | |||
| Inhibitor of cyclooxygenase-1 (EC 1.14.99.1) | |||
| Number of residues | 11 |
Activity code | cox1 |
| Activity : | cyclooxygenase-1 inhibitor |
|||
| Chemical mass | 1088.2536 | Monoisotopic mass | 1087.6007 | |
| IC50 : | 0.20 µM |
|||
| Bibliographic data: | |
| Authors | |
| Hayes M., Aluko R. E., Aurino E., Mora L. | |
| Title | |
| Generation of bioactive peptides from Porphyridium sp. and assessment of their potential for Use in the prevention of hypertension, inflammation and pain. Marine Drugs, 21, 422, 2023 | |
| Year | Source |
| 2023 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)N[C@@]([H])(C(C)C)C(=O)NCC(=O)N[C@@]([H])(CC(C)C)C(=O)O InChI=1S/C50H81N13O14/c1-10-28(8)41(61-43(69)31(51)17-25(2)3)47(73)58-32(19-30-21-52-24-55-30)44(70)56-29(9)42(68)59-33(20-39(66)67)48(74)63-16-12-14-36(63)49(75)62-15-11-13-35(62)45(71)53-23-38(65)60-40(27(6)7)46(72)54-22-37(64)57-34(50(76)77)18-26(4)5/h21,24-29,31-36,40-41H,10-20,22-23,51H2,1-9H3,(H,52,55)(H,53,71)(H,54,72)(H,56,70)(H,57,64)(H,58,73)(H,59,68)(H,60,65)(H,61,69)(H,66,67)(H,76,77)/t28-,29-,31-,32-,33-,34-,35-,36-,40-,41-/m0/s1 InChIKey=DCXDTNRFENTJGG-RNEJCJHHSA-N |
| Database reference: |