BIOPEP-UWM: Report
| ID | 10445 |
| Name | Dipeptidyl peptidase IV inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 7 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 739.7257 | Monoisotopic mass | 739.3013 | |
| IC50 : | 52.16 µM |
|||
| Bibliographic data: | |
| Authors | |
| Du X., Jiang C., Wang S., Jing H., Mo L., Ma C., Wang H. | |
| Title | |
| Preparation, identification, and inhibitory mechanism of dipeptidyl peptidase IV inhibitory peptides from goat milk whey protein. J. Food Sci., 88, 3577–3593, 2023 | |
| Year | Source |
| 2023 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CC(=O)O)C(=O)NCC(=O)N[C@@]([H])(CO)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)O InChI=1S/C31H45N7O14/c1-14(2)8-18(32)27(47)37-20(11-25(44)45)29(49)34-15(3)26(46)36-19(10-24(42)43)28(48)33-12-23(41)35-22(13-39)30(50)38-21(31(51)52)9-16-4-6-17(40)7-5-16/h4-7,14-15,18-22,39-40H,8-13,32H2,1-3H3,(H,33,48)(H,34,49)(H,35,41)(H,36,46)(H,37,47)(H,38,50)(H,42,43)(H,44,45)(H,51,52)/t15-,18-,19-,20-,21-,22-/m0/s1 InChIKey=GGWXCEYARKMFKR-TVVJCWKZSA-N |
| Database reference: |