BIOPEP-UWM: Report
| ID | 10446 |
| Name | Dipeptidyl peptidase IV inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 7 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 851.9394 | Monoisotopic mass | 851.4051 | |
| IC50 : | 175.70 µM |
|||
| Bibliographic data: | |
| Authors | |
| Du X., Jiang C., Wang S., Jing H., Mo L., Ma C., Wang H. | |
| Title | |
| Preparation, identification, and inhibitory mechanism of dipeptidyl peptidase IV inhibitory peptides from goat milk whey protein. J. Food Sci., 88, 3577–3593, 2023 | |
| Year | Source |
| 2023 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1)O)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)O InChI=1S/C42H57N7O12/c1-23(2)34(46-38(56)32-12-7-19-48(32)40(58)28(43)21-26-13-15-27(51)16-14-26)39(57)44-29(17-18-33(52)53)41(59)49-20-8-11-31(49)37(55)45-30(22-25-9-5-4-6-10-25)36(54)47-35(24(3)50)42(60)61/h4-6,9-10,13-16,23-24,28-32,34-35,50-51H,7-8,11-12,17-22,43H2,1-3H3,(H,44,57)(H,45,55)(H,46,56)(H,47,54)(H,52,53)(H,60,61)/t24-,28+,29+,30+,31+,32+,34+,35+/m1/s1 InChIKey=FZMMLGGZABAZMN-VTWNIBLCSA-N |
| Database reference: |