BIOPEP-UWM: Report
| ID | 10447 |
| Name | Dipeptidyl peptidase IV inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 5 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 640.6825 | Monoisotopic mass | 640.2847 | |
| IC50 : | 62.32 µM |
|||
| Bibliographic data: | |
| Authors | |
| Du X., Jiang C., Wang S., Jing H., Mo L., Ma C., Wang H. | |
| Title | |
| Preparation, identification, and inhibitory mechanism of dipeptidyl peptidase IV inhibitory peptides from goat milk whey protein. J. Food Sci., 88, 3577–3593, 2023 | |
| Year | Source |
| 2023 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(CC(=O)N)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)O InChI=1S/C31H40N6O9/c1-17(38)26(29(43)35-23(31(45)46)15-19-9-11-20(39)12-10-19)36-28(42)24-8-5-13-37(24)30(44)22(16-25(33)40)34-27(41)21(32)14-18-6-3-2-4-7-18/h2-4,6-7,9-12,17,21-24,26,38-39H,5,8,13-16,32H2,1H3,(H2,33,40)(H,34,41)(H,35,43)(H,36,42)(H,45,46)/t17-,21+,22+,23+,24+,26+/m1/s1 InChIKey=VXKGEYWADIKSEV-DOCZMJICSA-N |
| Database reference: |