BIOPEP-UWM: Report
| ID | 10477 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 4 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 569.6048 | Monoisotopic mass | 569.2477 | |
| IC50 : | 142.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Tang H., Wang C., Cao S., Wang F. | |
| Title | |
| Novel angiotensin I-converting enzyme (ACE) inhibitory peptides from walnut protein isolate: Separation, identification and molecular docking study. J. Food Biochem., 46, e14411, 2022. | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1)O)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)O InChI=1S/C28H35N5O8/c29-20(14-16-3-7-18(34)8-4-16)27(39)33-13-1-2-23(33)26(38)31-21(11-12-24(30)36)25(37)32-22(28(40)41)15-17-5-9-19(35)10-6-17/h3-10,20-23,34-35H,1-2,11-15,29H2,(H2,30,36)(H,31,38)(H,32,37)(H,40,41)/t20-,21-,22-,23-/m0/s1 InChIKey=AMKSMNMYJLJRQM-MLCQCVOFSA-N The IC50 value was calculated in μmol/L. |
| Database reference: |