BIOPEP-UWM: Report
| ID | 10480 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 14 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 1262.3480 | Monoisotopic mass | 1261.5702 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ren L., Fan J., Yang Y., Liu X., Wang B., Bian X., Wang D., Xu Y., Liu B., Zhu P., Zhang N. | |
| Title | |
| Identification, in silico selection, and mechanism study of novel antioxidant peptides derived from the rice bran protein hydrolysates. Food Chem. 408, 135230, 2023 | |
| Year | Source |
| 2023 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CC(C)C)C(=O)NCC(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)NCC(=O)NCC(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(C)C(=O)NCC(=O)N[C@@]([H])(CCSC)C(=O)O InChI=1S/C49H83N17O20S/c1-23(2)14-29(63-41(78)26(50)15-38(75)76)43(80)56-19-36(73)62-30(21-67)45(82)65-39(25(4)69)47(84)57-16-33(70)54-17-34(71)60-27(8-6-11-53-49(51)52)42(79)58-20-37(74)66-12-7-9-32(66)46(83)64-31(22-68)44(81)59-24(3)40(77)55-18-35(72)61-28(48(85)86)10-13-87-5/h23-32,39,67-69H,6-22,50H2,1-5H3,(H,54,70)(H,55,77)(H,56,80)(H,57,84)(H,58,79)(H,59,81)(H,60,71)(H,61,72)(H,62,73)(H,63,78)(H,64,83)(H,65,82)(H,75,76)(H,85,86)(H4,51,52,53)/t24-,25+,26-,27-,28-,29-,30-,31-,32-,39-/m0/s1 InChIKey=JLHPZIVLYSZIBO-WHQMLXESSA-N |
| Database reference: |