BIOPEP-UWM: Report
| ID | 10484 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 12 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 1380.5006 | Monoisotopic mass | 1379.6812 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ren L., Fan J., Yang Y., Liu X., Wang B., Bian X., Wang D., Xu Y., Liu B., Zhu P., Zhang N. | |
| Title | |
| Identification, in silico selection, and mechanism study of novel antioxidant peptides derived from the rice bran protein hydrolysates. Food Chem. 408, 135230, 2023 | |
| Year | Source |
| 2023 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(C)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@]([H])(C(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCCN)C(=O)O InChI=1S/C62H93N17O19/c1-6-32(4)50(61(96)79-23-13-17-43(79)58(93)70-37(62(97)98)16-10-11-21-63)77-56(91)38(24-34-14-8-7-9-15-34)73-54(89)40(26-46(66)81)74-55(90)42(28-48(84)85)75-59(94)44-18-12-22-78(44)60(95)49(31(2)3)76-57(92)39(25-35-29-67-30-68-35)71-51(86)33(5)69-53(88)41(27-47(82)83)72-52(87)36(64)19-20-45(65)80/h7-9,14-15,29-33,36-44,49-50H,6,10-13,16-28,63-64H2,1-5H3,(H2,65,80)(H2,66,81)(H,67,68)(H,69,88)(H,70,93)(H,71,86)(H,72,87)(H,73,89)(H,74,90)(H,75,94)(H,76,92)(H,77,91)(H,82,83)(H,84,85)(H,97,98)/t32-,33-,36-,37-,38-,39-,40-,41-,42-,43-,44-,49-,50-/m0/s1 InChIKey=IFRKRHSHDAPNLJ-VCWNVSTCSA-N |
| Database reference: |