BIOPEP-UWM: Report
| ID | 10504 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 8 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 864.9827 | Monoisotopic mass | 864.4690 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ren Q., Zhao H., Hu H., Zhou Z., Yang Z., Yang Z. | |
| Title | |
| Characterisation of a novel metalloprotease produced by Bacillus subtilis JQ-2 and casein-derived bioactive peptides by the protease. Int. Dairy J., 151, 105866, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CO)C(=O)N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C39H64N10O12/c1-5-21(4)31(38(59)48-15-7-10-27(48)37(58)49-16-8-11-28(49)39(60)61)46-34(55)24(18-30(42)52)44-33(54)23(12-13-29(41)51)43-35(56)26-9-6-14-47(26)36(57)25(17-20(2)3)45-32(53)22(40)19-50/h20-28,31,50H,5-19,40H2,1-4H3,(H2,41,51)(H2,42,52)(H,43,56)(H,44,54)(H,45,53)(H,46,55)(H,60,61)/t21-,22-,23-,24-,25-,26-,27-,28-,31-/m0/s1 InChIKey=XUJQBKQKQVCLEY-QFMWTSRZSA-N Inhibitor of α-glucosidase (EC 3.2.1.20) according to the BIOPEP-UWM database of bioactive peptides (ID 10507) |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 10507 |