BIOPEP-UWM: Report
| ID | 10505 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 8 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 868.9714 | Monoisotopic mass | 868.4639 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ren Q., Zhao H., Hu H., Zhou Z., Yang Z., Yang Z. | |
| Title | |
| Characterisation of a novel metalloprotease produced by Bacillus subtilis JQ-2 and casein-derived bioactive peptides by the protease. Int. Dairy J., 151, 105866, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(=O)N)C(=O)O InChI=1S/C38H64N10O13/c1-18(2)14-23(34(56)46-25(38(60)61)16-28(41)50)45-36(58)31(20(5)6)47-33(55)22(10-12-30(52)53)43-32(54)21(9-11-27(40)49)44-35(57)26-8-7-13-48(26)37(59)24(15-19(3)4)42-29(51)17-39/h18-26,31H,7-17,39H2,1-6H3,(H2,40,49)(H2,41,50)(H,42,51)(H,43,54)(H,44,57)(H,45,58)(H,46,56)(H,47,55)(H,52,53)(H,60,61)/t21-,22-,23-,24-,25-,26-,31-/m0/s1 InChIKey=BUURSOFJYVCTRI-SKXPDWFXSA-N Inhibitor of α-glucosidase (EC 3.2.1.20) according to the BIOPEP-UWM database of bioactive peptides (ID 10508) |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 10508 |