BIOPEP-UWM: Report
| ID | 10513 |
| Name | Butyrylcholinestrase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Butyrylcholinestrase (EC 3.1.1.8) | |||
| Number of residues | 5 |
Activity code | bche |
| Activity : | BChE inhibitor |
|||
| Chemical mass | 581.6204 | Monoisotopic mass | 581.2913 | |
| IC50 : | 1047.13 µM |
|||
| Bibliographic data: | |
| Authors | |
| Asen N.D., Okagu O.D., Udenigwe C.C., Aluko R.E. | |
| Title | |
| Butyrylcholinesterase inhibitory activity of peptides identified from yellow field pea (Pisum sativum) enzymatic protein hydrolysates. J. Funct. Foods, 106, 105590, 2023 | |
| Year | Source |
| 2023 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(C)C(=O)O InChI=1S/C24H39N9O8/c1-11(2)6-14(25)20(36)31-15(4-5-18(26)34)21(37)32-16(7-13-9-28-10-29-13)23(39)33-17(8-19(27)35)22(38)30-12(3)24(40)41/h9-12,14-17H,4-8,25H2,1-3H3,(H2,26,34)(H2,27,35)(H,28,29)(H,30,38)(H,31,36)(H,32,37)(H,33,39)(H,40,41)/t12-,14-,15-,16-,17-/m0/s1 InChIKey=INDPSEDSQKXVAM-SRQBIAJPSA-N Acetylcholinesterase inhibitor according to the BIOPEP-UWM database of bioactive peptides (ID 10488) |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 10488 |