BIOPEP-UWM: Report
| ID | 10516 |
| Name | Butyrylcholinestrase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Butyrylcholinesterase (EC 3.1.1.8) | |||
| Number of residues | 5 |
Activity code | bche |
| Activity : | BChE inhibitor |
|||
| Chemical mass | 619.6237 | Monoisotopic mass | 619.2916 | |
| IC50 : | 1122.02 µM |
|||
| Bibliographic data: | |
| Authors | |
| Asen N.D., Okagu O.D., Udenigwe C.C., Aluko R.E. | |
| Title | |
| Butyrylcholinesterase inhibitory activity of peptides identified from yellow field pea (Pisum sativum) enzymatic protein hydrolysates. J. Funct. Foods, 106, 105590, 2023 | |
| Year | Source |
| 2023 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)O InChI=1S/C23H41N9O11/c1-10(34)17(32-18(38)11(24)4-7-16(36)37)21(41)29-12(3-2-8-28-23(26)27)19(39)31-14(9-33)20(40)30-13(22(42)43)5-6-15(25)35/h10-14,17,33-34H,2-9,24H2,1H3,(H2,25,35)(H,29,41)(H,30,40)(H,31,39)(H,32,38)(H,36,37)(H,42,43)(H4,26,27,28)/t10-,11+,12+,13+,14+,17+/m1/s1 InChIKey=UBLCEYAHFHDAGS-UFRCXNNCSA-N Acetylcholinesterase inhibitor according to the BIOPEP-UWM database of bioactive peptides (ID 10491) |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 10491 |