BIOPEP-UWM: Report
| ID | 10518 |
| Name | Butyrylcholinestrase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Butyrylcholinestrase (EC 3.1.1.8) | |||
| Number of residues | 5 |
Activity code | bche |
| Activity : | BChE inhibitor |
|||
| Chemical mass | 643.6451 | Monoisotopic mass | 643.2916 | |
| IC50 : | 724.44 µM |
|||
| Bibliographic data: | |
| Authors | |
| Asen N.D., Okagu O.D., Udenigwe C.C., Aluko R.E. | |
| Title | |
| Butyrylcholinesterase inhibitory activity of peptides identified from yellow field pea (Pisum sativum) enzymatic protein hydrolysates. J. Funct. Foods, 106, 105590, 2023 | |
| Year | Source |
| 2023 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C25H41N9O11/c26-17(35)7-5-13(31-20(40)12-3-1-9-29-12)22(42)34-16(11-19(38)39)23(43)32-14(6-8-18(36)37)21(41)33-15(24(44)45)4-2-10-30-25(27)28/h12-16,29H,1-11H2,(H2,26,35)(H,31,40)(H,32,43)(H,33,41)(H,34,42)(H,36,37)(H,38,39)(H,44,45)(H4,27,28,30)/t12-,13-,14-,15-,16-/m0/s1 InChIKey=RVAWQBGMGYRXIC-QXKUPLGCSA-N Acetylcholinesterase inhibitor according to the BIOPEP-UWM database of bioactive peptides (ID 10493) |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 10493 |