BIOPEP-UWM: Report
| ID | 10521 |
| Name | Butyrylcholinestrase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Butyrylcholinestrase (EC 3.1.1.8) | |||
| Number of residues | 5 |
Activity code | bche |
| Activity : | BChE inhibitor |
|||
| Chemical mass | 690.7922 | Monoisotopic mass | 690.3915 | |
| IC50 : | 478.63 µM |
|||
| Bibliographic data: | |
| Authors | |
| Asen N.D., Okagu O.D., Udenigwe C.C., Aluko R.E. | |
| Title | |
| Butyrylcholinesterase inhibitory activity of peptides identified from yellow field pea (Pisum sativum) enzymatic protein hydrolysates. J. Funct. Foods, 106, 105590, 2023 | |
| Year | Source |
| 2023 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C30H50N12O7/c1-16(2)23(32)27(47)42-21(15-22(31)43)26(46)39-18(10-6-12-37-29(33)34)24(44)41-20(14-17-8-4-3-5-9-17)25(45)40-19(28(48)49)11-7-13-38-30(35)36/h3-5,8-9,16,18-21,23H,6-7,10-15,32H2,1-2H3,(H2,31,43)(H,39,46)(H,40,45)(H,41,44)(H,42,47)(H,48,49)(H4,33,34,37)(H4,35,36,38)/t18-,19-,20-,21-,23-/m0/s1 InChIKey=PEYLRWZVDUFAPX-JSSYZSAGSA-N Acetylcholinesterase inhibitor according to the BIOPEP-UWM database of bioactive peptides (ID 10496) |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 10496 |