BIOPEP-UWM: Report
| ID | 10523 |
| Name | Butyrylcholinestrase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Butyrylcholinesterase (EC 3.1.1.8) | |||
| Number of residues | 7 |
Activity code | bche |
| Activity : | BChE inhibitor |
|||
| Chemical mass | 720.8148 | Monoisotopic mass | 720.3907 | |
| IC50 : | 512.86 µM |
|||
| Bibliographic data: | |
| Authors | |
| Asen N.D., Okagu O.D., Udenigwe C.C., Aluko R.E. | |
| Title | |
| Butyrylcholinesterase inhibitory activity of peptides identified from yellow field pea (Pisum sativum) enzymatic protein hydrolysates. J. Funct. Foods, 106, 105590, 2023 | |
| Year | Source |
| 2023 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CN=C[NH]1)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(C)C(=O)O InChI=1S/C32H52N10O9/c1-7-16(4)25(30(48)39-21(12-23(34)43)27(45)38-18(6)32(50)51)41-26(44)17(5)37-29(47)24(15(2)3)40-28(46)22-9-8-10-42(22)31(49)20(33)11-19-13-35-14-36-19/h13-18,20-22,24-25H,7-12,33H2,1-6H3,(H2,34,43)(H,35,36)(H,37,47)(H,38,45)(H,39,48)(H,40,46)(H,41,44)(H,50,51)/t16-,17-,18-,20-,21-,22-,24-,25-/m0/s1 InChIKey=BBKXAVRFWBDRNC-YEKOUOQGSA-N Acetylcholinesterase inhibitor according to the BIOPEP-UWM database of bioactive peptides (ID 10498) |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 10498 |