BIOPEP-UWM: Report
| ID | 10528 |
| Name | Butyrylcholinestrase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Butyrylcholinestrase (EC 3.1.1.8) | |||
| Number of residues | 6 |
Activity code | bche |
| Activity : | BChE inhibitor |
|||
| Chemical mass | 731.7961 | Monoisotopic mass | 731.3914 | |
| IC50 : | 309.03 µM |
|||
| Bibliographic data: | |
| Authors | |
| Asen N.D., Okagu O.D., Udenigwe C.C., Aluko R.E. | |
| Title | |
| Butyrylcholinesterase inhibitory activity of peptides identified from yellow field pea (Pisum sativum) enzymatic protein hydrolysates. J. Funct. Foods, 106, 105590, 2023 | |
| Year | Source |
| 2023 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CO)C(=O)O InChI=1S/C29H53N11O11/c30-11-3-1-5-15(32)24(45)39-19(13-23(35)44)28(49)38-17(7-9-21(33)42)26(47)36-16(6-2-4-12-31)25(46)37-18(8-10-22(34)43)27(48)40-20(14-41)29(50)51/h15-20,41H,1-14,30-32H2,(H2,33,42)(H2,34,43)(H2,35,44)(H,36,47)(H,37,46)(H,38,49)(H,39,45)(H,40,48)(H,50,51)/t15-,16-,17-,18-,19-,20-/m0/s1 InChIKey=HHSAREWFNFCBPA-RABCQHRBSA-N Acetylcholinesterase inhibitor according to the BIOPEP-UWM database of bioactive peptides (ID 10503) |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 10503 |