BIOPEP-UWM: Report
| ID | 10533 |
| Name | Antibacterial peptide |
| sequence |
| Function: | |||
| Antibacterial | |||
| Number of residues | 7 |
Activity code | ab |
| Activity : | antibacterial |
|||
| Chemical mass | 874.9842 | Monoisotopic mass | 874.4760 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Song W., Kong X., Hu Y., Chen Y., Zhang C., Chen Y. | |
| Title | |
| Identification of antibacterial peptides generated from enzymatic hydrolysis of cottonseed proteins. LWT, 125, 109199, 2020 | |
| Year | Source |
| 2020 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C38H62N14O10/c39-15-5-4-11-23(40)31(56)50-26(20-30(54)55)33(58)51-27(19-22-9-2-1-3-10-22)35(60)52-18-8-14-28(52)34(59)47-21-29(53)48-24(12-6-16-45-37(41)42)32(57)49-25(36(61)62)13-7-17-46-38(43)44/h1-3,9-10,23-28H,4-8,11-21,39-40H2,(H,47,59)(H,48,53)(H,49,57)(H,50,56)(H,51,58)(H,54,55)(H,61,62)(H4,41,42,45)(H4,43,44,46)/t23-,24-,25-,26-,27-,28-/m0/s1 InChIKey=MXGUGSFMNNEWBG-QUQVWLGBSA-N |
| Database reference: |
| EROP-Moscow: ID E24846 |