BIOPEP-UWM: Report
| ID | 10534 |
| Name | Antibacterial peptide |
| sequence |
| Function: | |||
| Antibacterial | |||
| Number of residues | 12 |
Activity code | ab |
| Activity : | antibacterial |
|||
| Chemical mass | 1257.5428 | Monoisotopic mass | 1256.7252 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Song W., Kong X., Hu Y., Chen Y., Zhang C., Chen Y. | |
| Title | |
| Identification of antibacterial peptides generated from enzymatic hydrolysis of cottonseed proteins. LWT, 125, 109199, 2020 | |
| Year | Source |
| 2020 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)NCC(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(CO)C(=O)NCC(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CS)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(C(C)C)C(=O)O InChI=1S/C55H100N16O15S/c1-13-30(11)43(53(84)71-44(31(12)14-2)52(83)66-35(20-28(7)8)49(80)68-38(25-87)51(82)65-36(21-39(57)73)50(81)70-42(29(9)10)54(85)86)69-41(75)23-62-46(77)37(24-72)67-47(78)33(16-15-17-60-55(58)59)64-48(79)34(19-27(5)6)63-40(74)22-61-45(76)32(56)18-26(3)4/h26-38,42-44,72,87H,13-25,56H2,1-12H3,(H2,57,73)(H,61,76)(H,62,77)(H,63,74)(H,64,79)(H,65,82)(H,66,83)(H,67,78)(H,68,80)(H,69,75)(H,70,81)(H,71,84)(H,85,86)(H4,58,59,60)/t30-,31-,32-,33-,34-,35-,36-,37-,38-,42-,43-,44-/m0/s1 InChIKey=HYZUTXRRGMWTEG-LJIHREHDSA-N |
| Database reference: |
| EROP-Moscow: ID E24847 |