BIOPEP-UWM: Report
| ID | 10536 |
| Name | Antibacterial peptide |
| sequence |
| Function: | |||
| Antibacterial | |||
| Number of residues | 8 |
Activity code | ab |
| Activity : | antibacterial |
|||
| Chemical mass | 1115.2443 | Monoisotopic mass | 1114.5769 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Kong X., Song W., Hu Y., Li X., Chen Y., Zhang C., Chen Y. | |
| Title | |
| Insights into the antibacterial activity of cottonseed protein-derived peptide against Escherichia coli. Food Funct., 11, 10047-10057, 2020 | |
| Year | Source |
| 2020 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)O InChI=1S/C51H74N18O11/c1-28(2)18-37(45(75)68-40(49(79)80)20-30-12-14-33(71)15-13-30)66-48(78)41(25-70)69-46(76)38(19-29-8-4-3-5-9-29)67-44(74)36(11-7-17-60-51(55)56)63-43(73)35(10-6-16-59-50(53)54)64-47(77)39(22-32-24-58-27-62-32)65-42(72)34(52)21-31-23-57-26-61-31/h3-5,8-9,12-15,23-24,26-28,34-41,70-71H,6-7,10-11,16-22,25,52H2,1-2H3,(H,57,61)(H,58,62)(H,63,73)(H,64,77)(H,65,72)(H,66,78)(H,67,74)(H,68,75)(H,69,76)(H,79,80)(H4,53,54,59)(H4,55,56,60)/t34-,35-,36-,37-,38-,39-,40-,41-/m0/s1 InChIKey=UTKKOBMGKGILSY-PVEGFDORSA-N |
| Database reference: |