BIOPEP-UWM: Report
| ID | 10538 |
| Name | Antibacterial peptide |
| sequence |
| Function: | |||
| Antibacterial | |||
| Number of residues | 7 |
Activity code | ab |
| Activity : | antibacterial |
|||
| Chemical mass | 956.0535 | Monoisotopic mass | 955.4861 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Kong X., Song W., Hu Y., Li X., Chen Y., Zhang C., Chen Y. | |
| Title | |
| Insights into the antibacterial activity of cottonseed protein-derived peptide against Escherichia coli. Food Funct., 11, 10047-10057, 2020 | |
| Year | Source |
| 2020 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)O InChI=1S/C43H65N13O12/c1-23(2)18-29(52-36(62)28(11-7-17-50-43(47)48)51-35(61)27(44)10-6-16-49-42(45)46)37(63)53-30(19-24-8-4-3-5-9-24)38(64)56-33(22-57)40(66)54-31(21-34(59)60)39(65)55-32(41(67)68)20-25-12-14-26(58)15-13-25/h3-5,8-9,12-15,23,27-33,57-58H,6-7,10-11,16-22,44H2,1-2H3,(H,51,61)(H,52,62)(H,53,63)(H,54,66)(H,55,65)(H,56,64)(H,59,60)(H,67,68)(H4,45,46,49)(H4,47,48,50)/t27-,28-,29-,30-,31-,32-,33-/m0/s1 InChIKey=BQHKDMDYRXVMJS-MRNVWEPHSA-N |
| Database reference: |