BIOPEP-UWM: Report
| ID | 10539 |
| Name | Antioxidative |
| sequence |
| Function: | |||
| Number of residues | 2 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 178.2102 | Monoisotopic mass | 178.0410 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ai L., Liu L., Zheng L., Liu Y., Sun B., Su G., Xu J., Chen Y., Zhao M. | |
| Title | |
| An on-line stop-flow RPLC SEC-MS/DPPH radical scavenging activity analysis system and its application in separation and identification of antioxidant peptides. Food Chem., 436, 137670, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)N[C@@]([H])(CS)C(=O)O InChI=1S/C5H10N2O3S/c6-1-4(8)7-3(2-11)5(9)10/h3,11H,1-2,6H2,(H,7,8)(H,9,10)/t3-/m0/s1 InChIKey=RASXKWHKRYIYET-SCKGLCOQSA-N |
| Database reference: |