BIOPEP-UWM: Report
| ID | 10540 |
| Name | Antioxidative |
| sequence |
| Function: | |||
| Number of residues | 2 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 307.3685 | Monoisotopic mass | 307.0987 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ai L., Liu L., Zheng L., Liu Y., Sun B., Su G., Xu J., Chen Y., Zhao M. | |
| Title | |
| An on-line stop-flow RPLC SEC-MS/DPPH radical scavenging activity analysis system and its application in separation and identification of antioxidant peptides. Food Chem., 436, 137670, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CS)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)O InChI=1S/C14H17N3O3S/c15-10(7-21)13(18)17-12(14(19)20)5-8-6-16-11-4-2-1-3-9(8)11/h1-4,6,10,12,16,21H,5,7,15H2,(H,17,18)(H,19,20)/t10-,12-/m0/s1 InChIKey=SYELGNBERZZXAG-JQWIXIFHSA-N |
| Database reference: |
| CAS: Registry No 161559-67-7 ChEBI: ID 157817 EPA CompTox: ID DTXSID90778600 J-GLOBAL: ID 201107080445653294 Metabolomics Workbench: ID 78753 Nikkaji: ID J2.892.736C PubChem: CID 71353888 SureChEMBL: ID SCHEMBL14957775 |