BIOPEP-UWM: Report
| ID | 10541 |
| Name | Pancreatic lipase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of pancreatic lipase | |||
| Number of residues | 2 |
Activity code | plip |
| Activity : | pancreatic lipase inhibitor |
|||
| Chemical mass | 291.3018 | Monoisotopic mass | 291.1215 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Yang T., Cao S., Xie M., Shi T. | |
| Title | |
| Virtual screening, activity evaluation, and stability of pancreatic lipase inhibitors in the gastrointestinal degradation of nattokinase. Heliyon, 10, e24868, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CO)C(=O)N[C@@H](CC1=C[N]([H])C2=CC=CC=C12)C(=O)O InChI=1S/C14H17N3O4/c15-10(7-18)13(19)17-12(14(20)21)5-8-6-16-11-4-2-1-3-9(8)11/h1-4,6,10,12,16,18H,5,7,15H2,(H,17,19)(H,20,21)/t10-,12-/m0/s1 InChIKey=LZLREEUGSYITMX-JQWIXIFHSA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the PlantPepDB database Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) according to the BIOPEP-UWM database of bioactive peptides (ID 8896) |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 8896 ChEBI: ID 141445 ChemSpider: ID 76963306 FeptideDB: ID 8896 HMDB: ID HMDB0029050 PlantPepDB: ID PPepDB_3629 PubChem: CID 14409364 SureChEMBL: ID SCHEMBL5583849 |