BIOPEP-UWM: Report
| ID | 10542 |
| Name | Pancreatic lipase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of pancreatic lipase | |||
| Number of residues | 3 |
Activity code | plip |
| Activity : | pancreatic lipase inhibitor |
|||
| Chemical mass | 323.3435 | Monoisotopic mass | 323.1476 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Yang T., Cao S., Xie M., Shi T. | |
| Title | |
| Virtual screening, activity evaluation, and stability of pancreatic lipase inhibitors in the gastrointestinal degradation of nattokinase. Heliyon, 10, e24868, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C)C(=O)N[C@@]([H])(CO)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)O InChI=1S/C15H21N3O5/c1-9(16)13(20)18-12(8-19)14(21)17-11(15(22)23)7-10-5-3-2-4-6-10/h2-6,9,11-12,19H,7-8,16H2,1H3,(H,17,21)(H,18,20)(H,22,23)/t9-,11-,12-/m0/s1 InChIKey=PEEYDECOOVQKRZ-DLOVCJGASA-N |
| Database reference: |
| ChEBI: ID 158507 Metabolomics Workbench: ID 79369 PubChem: CID 145453666 |