BIOPEP-UWM: Report
| ID | 10544 |
| Name | Pancreatic lipase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of pancreatic lipase | |||
| Number of residues | 5 |
Activity code | plip |
| Activity : | pancreatic lipase inhibitor |
|||
| Chemical mass | 493.5090 | Monoisotopic mass | 493.2165 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Yang T., Cao S., Xie M., Shi T. | |
| Title | |
| Virtual screening, activity evaluation, and stability of pancreatic lipase inhibitors in the gastrointestinal degradation of nattokinase. Heliyon, 10, e24868, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N1[C@@]([H])(CCC1)C(=O)NCC(=O)NCC(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)O InChI=1S/C22H31N5O8/c1-12(28)19(21(33)26-16(22(34)35)9-13-4-6-14(29)7-5-13)27-18(31)11-24-17(30)10-25-20(32)15-3-2-8-23-15/h4-7,12,15-16,19,23,28-29H,2-3,8-11H2,1H3,(H,24,30)(H,25,32)(H,26,33)(H,27,31)(H,34,35)/t12-,15+,16+,19+/m1/s1 InChIKey=IQTBJLLOKJFEFA-OYWVLEMYSA-N |
| Database reference: |