BIOPEP-UWM: Report
| ID | 10556 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of angiotensin-converting enzyme (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 4 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 567.6319 | Monoisotopic mass | 567.2684 | |
| IC50 : | 90.40 µM |
|||
| Bibliographic data: | |
| Authors | |
| Hernandez-Ledesma B., Amigo L., Recio I., Bartolome B. | |
| Title | |
| ACE-inhibitory and radical scavenging activity of peptides derived from β-lactoglobulin f(19-25). Interactions with ascorbic acid. J. Agric. Food Chem., 55 (2007), 3392-3397. | |
| Year | Source |
| 2027 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CC(C)C)C(=O)O InChI=1S/C29H37N5O7/c1-16(2)11-24(29(40)41)33-28(39)25(15-35)34-27(38)23(12-17-7-9-19(36)10-8-17)32-26(37)21(30)13-18-14-31-22-6-4-3-5-20(18)22/h3-10,14,16,21,23-25,31,35-36H,11-13,15,30H2,1-2H3,(H,32,37)(H,33,39)(H,34,38)(H,40,41)/t21-,23-,24-,25-/m0/s1 InChIKey=BEGTZUPTEIHUQM-LFBFJMOVSA-N Antioxidative peptide according to the BIOPEP-UWM database of bioactive peptides (ID 7901); the DFBP database |
| Database reference: |
| AHTPD: ID ahtpdb_4889 BIOPEP-UWM database of bioactive peptides: ID 7901 DFBP: ID DFBPANOX0292; DFBPACEI0079; DFBPMUFU0037 EROP-Moscow: ID E10364 PubChem: CID 25052536 SATPdB: ID satpdb25921 |