BIOPEP-UWM: Report
| ID | 10557 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of angiotensin-converting enzyme (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 5 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 638.7096 | Monoisotopic mass | 638.3054 | |
| IC50 : | 86.90 µM |
|||
| Bibliographic data: | |
| Authors | |
| Hernandez-Ledesma B., Amigo L., Recio I., Bartolome B. | |
| Title | |
| ACE-inhibitory and radical scavenging activity of peptides derived from β-lactoglobulin f(19-25). Interactions with ascorbic acid. J. Agric. Food Chem., 55 (2007), 3392-3397. | |
| Year | Source |
| 2007 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(C)C(=O)O InChI=1S/C32H42N6O8/c1-17(2)12-25(29(42)35-18(3)32(45)46)37-31(44)27(16-39)38-30(43)26(13-19-8-10-21(40)11-9-19)36-28(41)23(33)14-20-15-34-24-7-5-4-6-22(20)24/h4-11,15,17-18,23,25-27,34,39-40H,12-14,16,33H2,1-3H3,(H,35,42)(H,36,41)(H,37,44)(H,38,43)(H,45,46)/t18-,23-,25-,26-,27-/m0/s1 InChIKey=BULJOIIMFHXRBC-ICMIYAPYSA-N Inhibitor of angiotensin-converting enzyme (EC 3.4.15.1) (MEROPS ID: M02-001) according to the BIOPEP-UWM database of bioactive peptides (ID 79020); the DFBP database; the EROP-Moscow database |
| Database reference: |
| AHTPDB: ID 6964 BIOPEP-UWM database of bioactive peptides: ID 7902 DFBP: ID DFBPACEI0080; DFBPANOX0293; DFBPMUFU0038 EROP-MOSCOW: E10365 SATPdb: ID satpdb26498 |