BIOPEP-UWM: Report
| ID | 10558 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of angiotensin-converting enzyme (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 6 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 769.9064 | Monoisotopic mass | 769.3457 | |
| IC50 : | 59.90 µM |
|||
| Bibliographic data: | |
| Authors | |
| Hernandez-Ledesma B., Amigo L., Recio I., Bartolome B. | |
| Title | |
| ACE-inhibitory and radical scavenging activity of peptides derived from β-lactoglobulin f(19-25). Interactions with ascorbic acid. J. Agric. Food Chem., 55 (2007), 3392-3397. | |
| Year | Source |
| 2007 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CCSC)C(=O)O InChI=1S/C37H51N7O9S/c1-20(2)15-29(34(49)40-21(3)32(47)41-28(37(52)53)13-14-54-4)43-36(51)31(19-45)44-35(50)30(16-22-9-11-24(46)12-10-22)42-33(48)26(38)17-23-18-39-27-8-6-5-7-25(23)27/h5-12,18,20-21,26,28-31,39,45-46H,13-17,19,38H2,1-4H3,(H,40,49)(H,41,47)(H,42,48)(H,43,51)(H,44,50)(H,52,53)/t21-,26-,28-,29-,30-,31-/m0/s1 InChIKey=SDXGIPZTSQUZRR-WPPHWVMVSA-N Antioxidative peptide according to the BIOPEP-UWM database of bioactive peptides (ID 7905); the DFBP database; the EROP-Moscow database |
| Database reference: |
| AHTPDB: ID 6965 BIOPEP-UWM database of bioactive peptides: ID 7905 DFBP: ID DFBPACEI0081; DFBPANOX0294; DFBPMUFU0039 EROP-Moscow: ID E10366 PubChem: CID 46233936 SATPdb: ID satpdb14140 |